C10H17N5 — CID 79826028
6-N-(1-methylpyrrolidin-3-yl)pyridine-2,3,6-triamine (PubChem CID 79826028) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 6-N-(1-methylpyrrolidin-3-yl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(1-methylpyrrolidin-3-yl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79826028 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 6-N-(1-methylpyrrolidin-3-yl)pyridine-2,3,6-triamine |
| SMILES | CN1CCC(Nc2ccc(N)c(N)n2)C1 |
| InChI | InChI=1S/C10H17N5/c1-15-5-4-7(6-15)13-9-3-2-8(11)10(12)14-9/h2-3,7H,4-6,11H2,1H3,(H3,12,13,14) |
| InChIKey | QZMMHKNEZBKIHO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |