C15H20N4 — CID 102984543
3-N-(2,3-dimethylcyclopentyl)quinoxaline-2,3-diamine (PubChem CID 102984543) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-N-(2,3-dimethylcyclopentyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(2,3-dimethylcyclopentyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102984543 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-N-(2,3-dimethylcyclopentyl)quinoxaline-2,3-diamine |
| SMILES | CC1CCC(Nc2nc3ccccc3nc2N)C1C |
| InChI | InChI=1S/C15H20N4/c1-9-7-8-11(10(9)2)18-15-14(16)17-12-5-3-4-6-13(12)19-15/h3-6,9-11H,7-8H2,1-2H3,(H2,16,17)(H,18,19) |
| InChIKey | JERJBQLJBHQLQK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |