C14H24N4 — CID 155223125
4-N-tert-butyl-1-N-pyrimidin-2-ylcyclohexane-1,4-diamine (PubChem CID 155223125) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-pyrimidin-2-ylcyclohexane-1,4-diamine.
| Compound Name | 4-N-tert-butyl-1-N-pyrimidin-2-ylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 155223125 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 4-N-tert-butyl-1-N-pyrimidin-2-ylcyclohexane-1,4-diamine |
| SMILES | CC(C)(C)NC1CCC(Nc2ncccn2)CC1 |
| InChI | InChI=1S/C14H24N4/c1-14(2,3)18-12-7-5-11(6-8-12)17-13-15-9-4-10-16-13/h4,9-12,18H,5-8H2,1-3H3,(H,15,16,17) |
| InChIKey | YFZLZSWIIAGHMU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |