C12H15N3OS — CID 140709737
4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine-2,10-diamine (PubChem CID 140709737) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine-2,10-diamine.
| Compound Name | 4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine-2,10-diamine |
|---|---|
| PubChem CID | 140709737 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine-2,10-diamine |
| SMILES | NC1=NC2c3cc(N)ccc3OCCC2SC1 |
| InChI | InChI=1S/C12H15N3OS/c13-7-1-2-9-8(5-7)12-10(3-4-16-9)17-6-11(14)15-12/h1-2,5,10,12H,3-4,6,13H2,(H2,14,15) |
| InChIKey | MGNWZLVVRWBVFQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|