C14H17NOS — CID 90301354
2,3-dimethyl-4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine (PubChem CID 90301354) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 2,3-dimethyl-4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine.
| Compound Name | 2,3-dimethyl-4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine |
|---|---|
| PubChem CID | 90301354 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2,3-dimethyl-4a,5,6,11b-tetrahydro-3H-[1]benzoxepino[4,5-b][1,4]thiazine |
| SMILES | CC1=NC2c3ccccc3OCCC2SC1C |
| InChI | InChI=1S/C14H17NOS/c1-9-10(2)17-13-7-8-16-12-6-4-3-5-11(12)14(13)15-9/h3-6,10,13-14H,7-8H2,1-2H3 |
| InChIKey | YRTNIBKUJXYIJA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |