C15H18N2O — CID 79101117
N-(3,4-dihydro-2H-chromen-4-yl)-2,5-dimethylpyrrol-1-amine (PubChem CID 79101117) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 79101117 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NC1CCOc2ccccc21 |
| InChI | InChI=1S/C15H18N2O/c1-11-7-8-12(2)17(11)16-14-9-10-18-15-6-4-3-5-13(14)15/h3-8,14,16H,9-10H2,1-2H3 |
| InChIKey | LDDKFDNYNIHFNW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |