C10H10O2 — CID 13149080
1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzoxepine (PubChem CID 13149080) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzoxepine.
| Compound Name | 1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzoxepine |
|---|---|
| PubChem CID | 13149080 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzoxepine |
| SMILES | c1ccc2c(c1)OCCC1OC21 |
| InChI | InChI=1S/C10H10O2/c1-2-4-8-7(3-1)10-9(12-10)5-6-11-8/h1-4,9-10H,5-6H2 |
| InChIKey | XVFOJIDWVXVMAE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|