C17H14O4 — CID 63709213
1,3-benzodioxol-5-yl(3,4-dihydro-2H-chromen-4-yl)methanone (PubChem CID 63709213) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(3,4-dihydro-2H-chromen-4-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl(3,4-dihydro-2H-chromen-4-yl)methanone |
|---|---|
| PubChem CID | 63709213 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1,3-benzodioxol-5-yl(3,4-dihydro-2H-chromen-4-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)C1CCOc2ccccc21 |
| InChI | InChI=1S/C17H14O4/c18-17(11-5-6-15-16(9-11)21-10-20-15)13-7-8-19-14-4-2-1-3-12(13)14/h1-6,9,13H,7-8,10H2 |
| InChIKey | BUUWBDKSPJWMEW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |