C16H13NO4 — CID 63709388
3,4-dihydro-2H-chromen-4-yl-(3-nitrophenyl)methanone (PubChem CID 63709388) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-4-yl-(3-nitrophenyl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-4-yl-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 63709388 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3,4-dihydro-2H-chromen-4-yl-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)C1CCOc2ccccc21 |
| InChI | InChI=1S/C16H13NO4/c18-16(11-4-3-5-12(10-11)17(19)20)14-8-9-21-15-7-2-1-6-13(14)15/h1-7,10,14H,8-9H2 |
| InChIKey | OGQIDWQYKNADKY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|