C20H21N3O4 — CID 31361844
N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-5-nitro-2-pyrrolidin-1-ylbenzamide (PubChem CID 31361844) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-5-nitro-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-5-nitro-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 31361844 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-chromen-4-yl]-5-nitro-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(N[C@H]1CCOc2ccccc21)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C20H21N3O4/c24-20(21-17-9-12-27-19-6-2-1-5-15(17)19)16-13-14(23(25)26)7-8-18(16)22-10-3-4-11-22/h1-2,5-8,13,17H,3-4,9-12H2,(H,21,24)/t17-/m0/s1 |
| InChIKey | AWDSVOXGVZTAFW-KRWDZBQOSA-N |
| XLogP | 3.45 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|