C22H23N3O7 — CID 46607103
[2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 46607103) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 46607103 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | [2-(3,4-dihydro-2H-chromen-4-ylamino)-2-oxoethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C22H23N3O7/c26-21(23-18-7-10-31-20-4-2-1-3-16(18)20)14-32-22(27)17-13-15(25(28)29)5-6-19(17)24-8-11-30-12-9-24/h1-6,13,18H,7-12,14H2,(H,23,26) |
| InChIKey | HKJOVHVCPCLYPT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|