C10H9NO — CID 51669858
(4S)-3,4-dihydro-2H-chromene-4-carbonitrile (PubChem CID 51669858) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is (4S)-3,4-dihydro-2H-chromene-4-carbonitrile.
| Compound Name | (4S)-3,4-dihydro-2H-chromene-4-carbonitrile |
|---|---|
| PubChem CID | 51669858 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | (4S)-3,4-dihydro-2H-chromene-4-carbonitrile |
| SMILES | N#C[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C10H9NO/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-4,8H,5-6H2/t8-/m1/s1 |
| InChIKey | ABAPCDWXFHBYPE-MRVPVSSYSA-N |
| XLogP | 2.08 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |