C13H12O3 — CID 64534380
methyl 3-(3,4-dihydro-2H-chromen-4-yl)prop-2-ynoate (PubChem CID 64534380) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 3-(3,4-dihydro-2H-chromen-4-yl)prop-2-ynoate.
| Compound Name | methyl 3-(3,4-dihydro-2H-chromen-4-yl)prop-2-ynoate |
|---|---|
| PubChem CID | 64534380 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | methyl 3-(3,4-dihydro-2H-chromen-4-yl)prop-2-ynoate |
| SMILES | COC(=O)C#CC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H12O3/c1-15-13(14)7-6-10-8-9-16-12-5-3-2-4-11(10)12/h2-5,10H,8-9H2,1H3 |
| InChIKey | SWXNQFJJZKFRME-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|