C16H15NO3 — CID 60655546
phenyl N-(3,4-dihydro-2H-chromen-4-yl)carbamate (PubChem CID 60655546) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is phenyl N-(3,4-dihydro-2H-chromen-4-yl)carbamate.
| Compound Name | phenyl N-(3,4-dihydro-2H-chromen-4-yl)carbamate |
|---|---|
| PubChem CID | 60655546 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | phenyl N-(3,4-dihydro-2H-chromen-4-yl)carbamate |
| SMILES | O=C(NC1CCOc2ccccc21)Oc1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c18-16(20-12-6-2-1-3-7-12)17-14-10-11-19-15-9-5-4-8-13(14)15/h1-9,14H,10-11H2,(H,17,18) |
| InChIKey | SLGYYGGAXXBTEA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |