C18H18N2O — CID 62779889
3-(3,4-dihydro-2H-chromen-4-ylamino)-3-phenylpropanenitrile (PubChem CID 62779889) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-ylamino)-3-phenylpropanenitrile.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-ylamino)-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 62779889 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-ylamino)-3-phenylpropanenitrile |
| SMILES | N#CCC(NC1CCOc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O/c19-12-10-16(14-6-2-1-3-7-14)20-17-11-13-21-18-9-5-4-8-15(17)18/h1-9,16-17,20H,10-11,13H2 |
| InChIKey | XJEWFPWYOHJAOQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |