C4H8N2O — CID 18734996
(5R)-5-methyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 18734996) has the molecular formula C4H8N2O and a molecular weight of 100.12 g/mol. Its IUPAC name is (5R)-5-methyl-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (5R)-5-methyl-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 18734996 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | (5R)-5-methyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | C[C@@H]1CN=C(N)O1 |
| InChI | InChI=1S/C4H8N2O/c1-3-2-6-4(5)7-3/h3H,2H2,1H3,(H2,5,6)/t3-/m1/s1 |
| InChIKey | ZHFKVNRMZIOKGZ-GSVOUGTGSA-N |
| XLogP | -0.28 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |