C9H10N2O — CID 132530511
5-methyl-2-pyridin-3-yl-4,5-dihydro-1,3-oxazole (PubChem CID 132530511) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-methyl-2-pyridin-3-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-methyl-2-pyridin-3-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132530511 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-methyl-2-pyridin-3-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1CN=C(c2cccnc2)O1 |
| InChI | InChI=1S/C9H10N2O/c1-7-5-11-9(12-7)8-3-2-4-10-6-8/h2-4,6-7H,5H2,1H3 |
| InChIKey | PPWWMZGYBFAHLV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |