C32H24N4 — CID 158129947
3-(3-pyridin-3-ylphenyl)pyridine;4-(3-pyridin-4-ylphenyl)pyridine (PubChem CID 158129947) has the molecular formula C32H24N4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-(3-pyridin-3-ylphenyl)pyridine;4-(3-pyridin-4-ylphenyl)pyridine.
| Compound Name | 3-(3-pyridin-3-ylphenyl)pyridine;4-(3-pyridin-4-ylphenyl)pyridine |
|---|---|
| PubChem CID | 158129947 |
| Molecular Formula | C32H24N4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 3-(3-pyridin-3-ylphenyl)pyridine;4-(3-pyridin-4-ylphenyl)pyridine |
| SMILES | c1cc(-c2ccncc2)cc(-c2ccncc2)c1.c1cncc(-c2cccc(-c3cccnc3)c2)c1 |
| InChI | InChI=1S/2C16H12N2/c1-4-13(15-6-2-8-17-11-15)10-14(5-1)16-7-3-9-18-12-16;1-2-15(13-4-8-17-9-5-13)12-16(3-1)14-6-10-18-11-7-14/h2*1-12H |
| InChIKey | FSQNLNAHRAWRCB-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |