C7H12IO5P — CID 144952765
2-hydroxy-4-(5-iodooxolan-2-yl)-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 144952765) has the molecular formula C7H12IO5P and a molecular weight of 334.05 g/mol. Its IUPAC name is 2-hydroxy-4-(5-iodooxolan-2-yl)-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-hydroxy-4-(5-iodooxolan-2-yl)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 144952765 |
| Molecular Formula | C7H12IO5P |
| Molecular Weight | 334.05 g/mol |
| Exact Mass | 333.95 |
| IUPAC Name | 2-hydroxy-4-(5-iodooxolan-2-yl)-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | O=P1(O)OCCC(C2CCC(I)O2)O1 |
| InChI | InChI=1S/C7H12IO5P/c8-7-2-1-5(12-7)6-3-4-11-14(9,10)13-6/h5-7H,1-4H2,(H,9,10) |
| InChIKey | QNDSOXLYCVNZFO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.05 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|