C22H21N2O5P — CID 46931382
1-[4-[4-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl)phenyl]phenyl]-3-phenylurea (PubChem CID 46931382) has the molecular formula C22H21N2O5P and a molecular weight of 424.39 g/mol. Its IUPAC name is 1-[4-[4-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl)phenyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[4-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl)phenyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 46931382 |
| Molecular Formula | C22H21N2O5P |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[4-[4-(2-hydroxy-2-oxo-1,3,2λ5-dioxaphosphinan-4-yl)phenyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(-c2ccc(C3CCOP(=O)(O)O3)cc2)cc1 |
| InChI | InChI=1S/C22H21N2O5P/c25-22(23-19-4-2-1-3-5-19)24-20-12-10-17(11-13-20)16-6-8-18(9-7-16)21-14-15-28-30(26,27)29-21/h1-13,21H,14-15H2,(H,26,27)(H2,23,24,25) |
| InChIKey | ZWJAGDQXHVCRJX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|