C18H19N3O4 — CID 78150293
1-[4-[3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3-phenylurea (PubChem CID 78150293) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[4-[3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 78150293 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[4-[3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3-phenylurea |
| SMILES | O=C1COC(c2ccc(NC(=O)Nc3ccccc3)cc2)C(CO)N1 |
| InChI | InChI=1S/C18H19N3O4/c22-10-15-17(25-11-16(23)21-15)12-6-8-14(9-7-12)20-18(24)19-13-4-2-1-3-5-13/h1-9,15,17,22H,10-11H2,(H,21,23)(H2,19,20,24) |
| InChIKey | AGGNEWDLJBZORR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |