C20H23N3O4 — CID 78150664
1-benzyl-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea (PubChem CID 78150664) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-benzyl-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 78150664 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-benzyl-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea |
| SMILES | CN1C(=O)COC(c2ccc(NC(=O)NCc3ccccc3)cc2)C1CO |
| InChI | InChI=1S/C20H23N3O4/c1-23-17(12-24)19(27-13-18(23)25)15-7-9-16(10-8-15)22-20(26)21-11-14-5-3-2-4-6-14/h2-10,17,19,24H,11-13H2,1H3,(H2,21,22,26) |
| InChIKey | AQZPKSGXKITXKV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |