C26H26N2O4 — CID 78150332
N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-2-methylbenzamide (PubChem CID 78150332) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 78150332 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(C2OCC(=O)N(Cc3ccccc3)C2CO)cc1 |
| InChI | InChI=1S/C26H26N2O4/c1-18-7-5-6-10-22(18)26(31)27-21-13-11-20(12-14-21)25-23(16-29)28(24(30)17-32-25)15-19-8-3-2-4-9-19/h2-14,23,25,29H,15-17H2,1H3,(H,27,31) |
| InChIKey | PVUVWEKNDFHOOZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |