About N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide
N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide (PubChem CID 78150337) has the molecular formula C25H22F2N2O4
and a molecular weight of 452.46 g/mol. Its IUPAC name is N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide.
Molecular Properties
| Compound Name | N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide |
| PubChem CID | 78150337 |
| Molecular Formula | C25H22F2N2O4 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc(C2OCC(=O)N(Cc3ccccc3)C2CO)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H22F2N2O4/c26-19-10-18(11-20(27)12-19)25(32)28-21-8-6-17(7-9-21)24-22(14-30)29(23(31)15-33-24)13-16-4-2-1-3-5-16/h1-12,22,24,30H,13-15H2,(H,28,32) |
| InChIKey | ZXEAEXUVRDCSDC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide?
The IUPAC name of N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide (CID 78150337) is N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide.
What is the SMILES notation for N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide?
The canonical SMILES for N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide is O=C(Nc1ccc(C2OCC(=O)N(Cc3ccccc3)C2CO)cc1)c1cc(F)cc(F)c1.
What is the InChIKey of N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide?
The InChIKey is ZXEAEXUVRDCSDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22F2N2O4/c26-19-10-18(11-20(27)12-19)25(32)28-21-8-6-17(7-9-21)24-22(14-30)29(23(31)15-33-24)13-16-4-2-1-3-5-16/h1-12,22,24,30H,13-15H2,(H,28,32).
What are the key properties of N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide?
N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide has a molecular weight of 452.46 g/mol, XLogP of 3.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-benzyl-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]-3,5-difluorobenzamide is sourced from PubChem (CID 78150337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).