C19H20FN3O4 — CID 78150676
1-(4-fluorophenyl)-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea (PubChem CID 78150676) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 78150676 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]urea |
| SMILES | CN1C(=O)COC(c2ccc(NC(=O)Nc3ccc(F)cc3)cc2)C1CO |
| InChI | InChI=1S/C19H20FN3O4/c1-23-16(10-24)18(27-11-17(23)25)12-2-6-14(7-3-12)21-19(26)22-15-8-4-13(20)5-9-15/h2-9,16,18,24H,10-11H2,1H3,(H2,21,22,26) |
| InChIKey | BYSSVEXTISDMBG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |