C16H23N3O4 — CID 78150679
1-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea (PubChem CID 78150679) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 78150679 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-[4-[3-(hydroxymethyl)-4-methyl-5-oxomorpholin-2-yl]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(C2OCC(=O)N(C)C2CO)cc1 |
| InChI | InChI=1S/C16H23N3O4/c1-10(2)17-16(22)18-12-6-4-11(5-7-12)15-13(8-20)19(3)14(21)9-23-15/h4-7,10,13,15,20H,8-9H2,1-3H3,(H2,17,18,22) |
| InChIKey | WFDHUDKZLYLOQS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |