C19H17N3O4 — CID 71693238
4-cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]benzamide (PubChem CID 71693238) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]benzamide.
| Compound Name | 4-cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 71693238 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 4-cyano-N-[4-[(2R,3R)-3-(hydroxymethyl)-5-oxomorpholin-2-yl]phenyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc([C@H]3OCC(=O)N[C@@H]3CO)cc2)cc1 |
| InChI | InChI=1S/C19H17N3O4/c20-9-12-1-3-14(4-2-12)19(25)21-15-7-5-13(6-8-15)18-16(10-23)22-17(24)11-26-18/h1-8,16,18,23H,10-11H2,(H,21,25)(H,22,24)/t16-,18-/m1/s1 |
| InChIKey | RUZUMHBNNMOQMK-SJLPKXTDSA-N |
| XLogP | 1.36 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |