C8H15O6P — CID 154987852
(4aR,6S)-2-hydroxy-2-oxo-6-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 154987852) has the molecular formula C8H15O6P and a molecular weight of 238.18 g/mol. Its IUPAC name is (4aR,6S)-2-hydroxy-2-oxo-6-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (4aR,6S)-2-hydroxy-2-oxo-6-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 154987852 |
| Molecular Formula | C8H15O6P |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | (4aR,6S)-2-hydroxy-2-oxo-6-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | CC(C)[C@@H]1O[C@@H]2COP(=O)(O)OC2C1O |
| InChI | InChI=1S/C8H15O6P/c1-4(2)7-6(9)8-5(13-7)3-12-15(10,11)14-8/h4-9H,3H2,1-2H3,(H,10,11)/t5-,6?,7+,8?/m1/s1 |
| InChIKey | IJJGXFGAPMEKDM-RRABCLCVSA-N |
| XLogP | 0.29 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|