C8H13O8P — CID 23271411
(1R,3R,5S,7R,8R,9R)-11-hydroxy-5-methyl-11-oxo-2,4,6,10,12-pentaoxa-11λ5-phosphatricyclo[7.4.0.03,7]tridecan-8-ol (PubChem CID 23271411) has the molecular formula C8H13O8P and a molecular weight of 268.16 g/mol. Its IUPAC name is (1R,3R,5S,7R,8R,9R)-11-hydroxy-5-methyl-11-oxo-2,4,6,10,12-pentaoxa-11λ5-phosphatricyclo[7.4.0.03,7]tridecan-8-ol.
| Compound Name | (1R,3R,5S,7R,8R,9R)-11-hydroxy-5-methyl-11-oxo-2,4,6,10,12-pentaoxa-11λ5-phosphatricyclo[7.4.0.03,7]tridecan-8-ol |
|---|---|
| PubChem CID | 23271411 |
| Molecular Formula | C8H13O8P |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (1R,3R,5S,7R,8R,9R)-11-hydroxy-5-methyl-11-oxo-2,4,6,10,12-pentaoxa-11λ5-phosphatricyclo[7.4.0.03,7]tridecan-8-ol |
| SMILES | C[C@@H]1O[C@H]2O[C@@H]3COP(=O)(O)O[C@@H]3[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C8H13O8P/c1-3-13-7-5(9)6-4(15-8(7)14-3)2-12-17(10,11)16-6/h3-9H,2H2,1H3,(H,10,11)/t3-,4+,5-,6-,7+,8-/m0/s1 |
| InChIKey | HUHXUQOKSGWPHJ-LXTFHKNLSA-N |
| XLogP | -0.65 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|