C9H12O5 — CID 143686227
(2S,6aS)-3-hydroxy-2-propan-2-yl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-5,6-dione (PubChem CID 143686227) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (2S,6aS)-3-hydroxy-2-propan-2-yl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-5,6-dione.
| Compound Name | (2S,6aS)-3-hydroxy-2-propan-2-yl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-5,6-dione |
|---|---|
| PubChem CID | 143686227 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (2S,6aS)-3-hydroxy-2-propan-2-yl-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-5,6-dione |
| SMILES | CC(C)[C@@H]1O[C@@H]2C(=O)C(=O)OC2C1O |
| InChI | InChI=1S/C9H12O5/c1-3(2)6-4(10)7-8(13-6)5(11)9(12)14-7/h3-4,6-8,10H,1-2H3/t4?,6-,7?,8+/m0/s1 |
| InChIKey | CFWMLDIMXYYILB-UANZIBEISA-N |
| XLogP | -0.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|