C7H10O5 — CID 91235540
4-hydroxy-5-(1-hydroxypropyl)oxolane-2,3-dione (PubChem CID 91235540) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 4-hydroxy-5-(1-hydroxypropyl)oxolane-2,3-dione.
| Compound Name | 4-hydroxy-5-(1-hydroxypropyl)oxolane-2,3-dione |
|---|---|
| PubChem CID | 91235540 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 4-hydroxy-5-(1-hydroxypropyl)oxolane-2,3-dione |
| SMILES | CCC(O)C1OC(=O)C(=O)C1O |
| InChI | InChI=1S/C7H10O5/c1-2-3(8)6-4(9)5(10)7(11)12-6/h3-4,6,8-9H,2H2,1H3 |
| InChIKey | CRIKOESFJDHIIB-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|