C11H18O8 — CID 123865037
5-(1,2-dihydroxyethyl)-4-(3-ethoxy-2-hydroxypropoxy)oxolane-2,3-dione (PubChem CID 123865037) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 5-(1,2-dihydroxyethyl)-4-(3-ethoxy-2-hydroxypropoxy)oxolane-2,3-dione.
| Compound Name | 5-(1,2-dihydroxyethyl)-4-(3-ethoxy-2-hydroxypropoxy)oxolane-2,3-dione |
|---|---|
| PubChem CID | 123865037 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-(1,2-dihydroxyethyl)-4-(3-ethoxy-2-hydroxypropoxy)oxolane-2,3-dione |
| SMILES | CCOCC(O)COC1C(=O)C(=O)OC1C(O)CO |
| InChI | InChI=1S/C11H18O8/c1-2-17-4-6(13)5-18-10-8(15)11(16)19-9(10)7(14)3-12/h6-7,9-10,12-14H,2-5H2,1H3 |
| InChIKey | XHMSDBFWKSLHBF-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|