C20H36O10 — CID 90792660
(5R)-5-[(1S)-1,2-dihydroxyethyl]-4-[3-hydroxy-1-(2-hydroxypropoxy)-2-octoxypropoxy]oxolane-2,3-dione (PubChem CID 90792660) has the molecular formula C20H36O10 and a molecular weight of 436.50 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-[3-hydroxy-1-(2-hydroxypropoxy)-2-octoxypropoxy]oxolane-2,3-dione.
| Compound Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-[3-hydroxy-1-(2-hydroxypropoxy)-2-octoxypropoxy]oxolane-2,3-dione |
|---|---|
| PubChem CID | 90792660 |
| Molecular Formula | C20H36O10 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-[3-hydroxy-1-(2-hydroxypropoxy)-2-octoxypropoxy]oxolane-2,3-dione |
| SMILES | CCCCCCCCOC(CO)C(OCC(C)O)OC1C(=O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C20H36O10/c1-3-4-5-6-7-8-9-27-15(11-22)20(28-12-13(2)23)30-18-16(25)19(26)29-17(18)14(24)10-21/h13-15,17-18,20-24H,3-12H2,1-2H3/t13?,14-,15?,17+,18?,20?/m0/s1 |
| InChIKey | LMOCMGQDWKGOAZ-IWYKQIDXSA-N |
| XLogP | -0.32 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|