C40H74O16 — CID 91352957
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihexoxy-2,3-dihexyl-4,5,6,7,8,9,10-heptahydroxydecanoate (PubChem CID 91352957) has the molecular formula C40H74O16 and a molecular weight of 811.02 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihexoxy-2,3-dihexyl-4,5,6,7,8,9,10-heptahydroxydecanoate.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihexoxy-2,3-dihexyl-4,5,6,7,8,9,10-heptahydroxydecanoate |
|---|---|
| PubChem CID | 91352957 |
| Molecular Formula | C40H74O16 |
| Molecular Weight | 811.02 g/mol |
| Exact Mass | 810.50 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihexoxy-2,3-dihexyl-4,5,6,7,8,9,10-heptahydroxydecanoate |
| SMILES | CCCCCCOC(CCCCCC)(C(=O)OC1C(=O)C(=O)O[C@@H]1[C@@H](O)CO)C(CCCCCC)(OCCCCCC)C(O)C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C40H74O16/c1-5-9-13-17-21-39(53-23-19-15-11-7-3,36(50)32(48)31(47)30(46)29(45)27(43)25-41)40(22-18-14-10-6-2,54-24-20-16-12-8-4)38(52)56-35-33(49)37(51)55-34(35)28(44)26-42/h27-32,34-36,41-48,50H,5-26H2,1-4H3/t27?,28-,29?,30?,31?,32?,34+,35?,36?,39?,40?/m0/s1 |
| InChIKey | ZPPLVPROVPABJK-MOJMOMLNSA-N |
| XLogP | 1.52 |
| TPSA | 270.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.02 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|