C13H22O13 — CID 90992471
[(3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl] 2,3,4,5,6,7-hexahydroxyheptanoate (PubChem CID 90992471) has the molecular formula C13H22O13 and a molecular weight of 386.31 g/mol. Its IUPAC name is [(3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl] 2,3,4,5,6,7-hexahydroxyheptanoate.
| Compound Name | [(3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl] 2,3,4,5,6,7-hexahydroxyheptanoate |
|---|---|
| PubChem CID | 90992471 |
| Molecular Formula | C13H22O13 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(3R,4S,5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxy-2-oxooxolan-3-yl] 2,3,4,5,6,7-hexahydroxyheptanoate |
| SMILES | O=C(O[C@H]1C(=O)O[C@H]([C@H](O)CO)[C@@H]1O)C(O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C13H22O13/c14-1-3(16)5(18)6(19)7(20)8(21)12(23)26-11-9(22)10(4(17)2-15)25-13(11)24/h3-11,14-22H,1-2H2/t3?,4-,5?,6?,7?,8?,9+,10-,11-/m1/s1 |
| InChIKey | XLAMJUBCKHBUOG-GJFDEZHGSA-N |
| XLogP | -6.67 |
| TPSA | 234.67 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | -6.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |