C10H14O10 — CID 54419445
[(2R)-2-[(1R)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] (2R,3R)-2,3,4-trihydroxybutanoate (PubChem CID 54419445) has the molecular formula C10H14O10 and a molecular weight of 294.21 g/mol. Its IUPAC name is [(2R)-2-[(1R)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] (2R,3R)-2,3,4-trihydroxybutanoate.
| Compound Name | [(2R)-2-[(1R)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] (2R,3R)-2,3,4-trihydroxybutanoate |
|---|---|
| PubChem CID | 54419445 |
| Molecular Formula | C10H14O10 |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | [(2R)-2-[(1R)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] (2R,3R)-2,3,4-trihydroxybutanoate |
| SMILES | O=C1O[C@H]([C@H](O)CO)C(OC(=O)[C@H](O)[C@H](O)CO)C1=O |
| InChI | InChI=1S/C10H14O10/c11-1-3(13)5(15)9(17)20-8-6(16)10(18)19-7(8)4(14)2-12/h3-5,7-8,11-15H,1-2H2/t3-,4-,5-,7-,8?/m1/s1 |
| InChIKey | VZSYKTJLWJCAPT-OMAYUESXSA-N |
| XLogP | -4.54 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|