C6H10O6Si — CID 123360045
(5R)-5-[(1S)-1,2-dihydroxyethyl]-4-silyloxyoxolane-2,3-dione (PubChem CID 123360045) has the molecular formula C6H10O6Si and a molecular weight of 206.23 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-silyloxyoxolane-2,3-dione.
| Compound Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-silyloxyoxolane-2,3-dione |
|---|---|
| PubChem CID | 123360045 |
| Molecular Formula | C6H10O6Si |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-silyloxyoxolane-2,3-dione |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O[SiH3])C1=O |
| InChI | InChI=1S/C6H10O6Si/c7-1-2(8)4-5(12-13)3(9)6(10)11-4/h2,4-5,7-8H,1H2,13H3/t2-,4+,5?/m0/s1 |
| InChIKey | KHIKSKWKHGJZQB-VMDATRFYSA-N |
| XLogP | -3.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|