C9H12O7 — CID 54208151
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] propanoate (PubChem CID 54208151) has the molecular formula C9H12O7 and a molecular weight of 232.19 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] propanoate.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] propanoate |
|---|---|
| PubChem CID | 54208151 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] propanoate |
| SMILES | CCC(=O)OC1C(=O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C9H12O7/c1-2-5(12)15-8-6(13)9(14)16-7(8)4(11)3-10/h4,7-8,10-11H,2-3H2,1H3/t4-,7+,8?/m0/s1 |
| InChIKey | PTZYXTVHLMEUAO-CNBJFDCFSA-N |
| XLogP | -1.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|