C9H15O11P — CID 90972691
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihydroxypropyl hydrogen phosphate (PubChem CID 90972691) has the molecular formula C9H15O11P and a molecular weight of 330.18 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihydroxypropyl hydrogen phosphate.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihydroxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 90972691 |
| Molecular Formula | C9H15O11P |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] 2,3-dihydroxypropyl hydrogen phosphate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(OP(=O)(O)OCC(O)CO)C1=O |
| InChI | InChI=1S/C9H15O11P/c10-1-4(12)3-18-21(16,17)20-8-6(14)9(15)19-7(8)5(13)2-11/h4-5,7-8,10-13H,1-3H2,(H,16,17)/t4?,5-,7+,8?/m0/s1 |
| InChIKey | UDQGLPVGFPZMFO-XVMLKPHDSA-N |
| XLogP | -3.31 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|