C14H29O11P — CID 118407888
2,3-dihydroxypropyl [(3S,5R,6R)-2,3,4,5,6-pentamethoxycyclohexyl] hydrogen phosphate (PubChem CID 118407888) has the molecular formula C14H29O11P and a molecular weight of 404.35 g/mol. Its IUPAC name is 2,3-dihydroxypropyl [(3S,5R,6R)-2,3,4,5,6-pentamethoxycyclohexyl] hydrogen phosphate.
| Compound Name | 2,3-dihydroxypropyl [(3S,5R,6R)-2,3,4,5,6-pentamethoxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 118407888 |
| Molecular Formula | C14H29O11P |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2,3-dihydroxypropyl [(3S,5R,6R)-2,3,4,5,6-pentamethoxycyclohexyl] hydrogen phosphate |
| SMILES | COC1C(OP(=O)(O)OCC(O)CO)[C@H](OC)[C@H](OC)C(OC)[C@@H]1OC |
| InChI | InChI=1S/C14H29O11P/c1-19-9-10(20-2)12(22-4)14(13(23-5)11(9)21-3)25-26(17,18)24-7-8(16)6-15/h8-16H,6-7H2,1-5H3,(H,17,18)/t8?,9?,10-,11+,12-,13?,14?/m1/s1 |
| InChIKey | ZTECHUXOPVUNGR-TYTBIRNCSA-N |
| XLogP | -1.07 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|