C12H15O14P — CID 54319109
bis[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] hydrogen phosphate (PubChem CID 54319109) has the molecular formula C12H15O14P and a molecular weight of 414.21 g/mol. Its IUPAC name is bis[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] hydrogen phosphate.
| Compound Name | bis[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 54319109 |
| Molecular Formula | C12H15O14P |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | bis[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4,5-dioxooxolan-3-yl] hydrogen phosphate |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(OP(=O)(O)OC2C(=O)C(=O)O[C@@H]2[C@@H](O)CO)C1=O |
| InChI | InChI=1S/C12H15O14P/c13-1-3(15)7-9(5(17)11(19)23-7)25-27(21,22)26-10-6(18)12(20)24-8(10)4(16)2-14/h3-4,7-10,13-16H,1-2H2,(H,21,22)/t3-,4-,7+,8+,9?,10?/m0/s1 |
| InChIKey | SQIXGZYAGBDLTC-SDVRZOACSA-N |
| XLogP | -4.45 |
| TPSA | 223.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|