C6H8O3 — CID 124583750
(2R)-4-ethyl-2-hydroxy-2H-furan-5-one (PubChem CID 124583750) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is (2R)-4-ethyl-2-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-4-ethyl-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 124583750 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (2R)-4-ethyl-2-hydroxy-2H-furan-5-one |
| SMILES | CCC1=C[C@H](O)OC1=O |
| InChI | InChI=1S/C6H8O3/c1-2-4-3-5(7)9-6(4)8/h3,5,7H,2H2,1H3/t5-/m1/s1 |
| InChIKey | QCBSIVCQQPAZMF-RXMQYKEDSA-N |
| XLogP | 0.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |