C9H13NO3 — CID 143686303
5-hydroxy-4-propan-2-yl-3,7-dioxabicyclo[4.1.0]heptane-2-carbonitrile (PubChem CID 143686303) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-hydroxy-4-propan-2-yl-3,7-dioxabicyclo[4.1.0]heptane-2-carbonitrile.
| Compound Name | 5-hydroxy-4-propan-2-yl-3,7-dioxabicyclo[4.1.0]heptane-2-carbonitrile |
|---|---|
| PubChem CID | 143686303 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-hydroxy-4-propan-2-yl-3,7-dioxabicyclo[4.1.0]heptane-2-carbonitrile |
| SMILES | CC(C)C1OC(C#N)C2OC2C1O |
| InChI | InChI=1S/C9H13NO3/c1-4(2)7-6(11)9-8(13-9)5(3-10)12-7/h4-9,11H,1-2H3 |
| InChIKey | AHUDIVGSALIUMY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|