About (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol
(3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol (PubChem CID 140835106) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol.
Analyze (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol?
The IUPAC name of (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol (CID 140835106) is (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol.
What is the SMILES notation for (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol?
The canonical SMILES for (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol is OC1C2O[C@H]3C(O)C2O[C@@H]13.
What is the InChIKey of (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol?
The InChIKey is ZMVNENIXLVZSJN-FDOQJFGUSA-N. The full InChI is InChI=1S/C6H8O4/c7-1-3-5-2(8)6(9-3)4(1)10-5/h1-8H/t1?,2?,3-,4?,5-,6?/m0/s1.
What are the key properties of (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol?
(3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol has a molecular weight of 144.13 g/mol, XLogP of -1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,7S)-2,6-dioxatricyclo[3.3.0.03,7]octane-4,8-diol is sourced from PubChem (CID 140835106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).