C8H12O4 — CID 25186851
(1aR,2S,3S,3aS,6aR,6bS)-1a,2,3,3a,4,6,6a,6b-octahydrooxireno[2,3-g][2]benzofuran-2,3-diol (PubChem CID 25186851) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (1aR,2S,3S,3aS,6aR,6bS)-1a,2,3,3a,4,6,6a,6b-octahydrooxireno[2,3-g][2]benzofuran-2,3-diol.
| Compound Name | (1aR,2S,3S,3aS,6aR,6bS)-1a,2,3,3a,4,6,6a,6b-octahydrooxireno[2,3-g][2]benzofuran-2,3-diol |
|---|---|
| PubChem CID | 25186851 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (1aR,2S,3S,3aS,6aR,6bS)-1a,2,3,3a,4,6,6a,6b-octahydrooxireno[2,3-g][2]benzofuran-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@H]2O[C@H]2[C@H]2COC[C@@H]12 |
| InChI | InChI=1S/C8H12O4/c9-5-3-1-11-2-4(3)7-8(12-7)6(5)10/h3-10H,1-2H2/t3-,4+,5+,6+,7+,8-/m1/s1 |
| InChIKey | RWZXMPUQZUJTLK-ZWDHIVPGSA-N |
| XLogP | -1.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|