C9H14O2 — CID 131155626
(1R,2S,4R,5S,6R,7R)-7-methyl-3-oxatricyclo[3.2.2.02,4]nonan-6-ol (PubChem CID 131155626) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (1R,2S,4R,5S,6R,7R)-7-methyl-3-oxatricyclo[3.2.2.02,4]nonan-6-ol.
| Compound Name | (1R,2S,4R,5S,6R,7R)-7-methyl-3-oxatricyclo[3.2.2.02,4]nonan-6-ol |
|---|---|
| PubChem CID | 131155626 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (1R,2S,4R,5S,6R,7R)-7-methyl-3-oxatricyclo[3.2.2.02,4]nonan-6-ol |
| SMILES | C[C@H]1[C@@H](O)[C@@H]2CC[C@H]1[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C9H14O2/c1-4-5-2-3-6(7(4)10)9-8(5)11-9/h4-10H,2-3H2,1H3/t4-,5-,6+,7-,8+,9-/m1/s1 |
| InChIKey | DYTKCLPGPWAMNQ-MSKRCNKPSA-N |
| XLogP | 0.79 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|