C10H18O2 — CID 130927438
(1S,2R,3R,3aS,6R,6aS)-3,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,2-diol (PubChem CID 130927438) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S,2R,3R,3aS,6R,6aS)-3,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,2-diol.
| Compound Name | (1S,2R,3R,3aS,6R,6aS)-3,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,2-diol |
|---|---|
| PubChem CID | 130927438 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1S,2R,3R,3aS,6R,6aS)-3,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,2-diol |
| SMILES | C[C@H]1[C@@H](O)[C@@H](O)[C@@H]2[C@H]1CC[C@H]2C |
| InChI | InChI=1S/C10H18O2/c1-5-3-4-7-6(2)9(11)10(12)8(5)7/h5-12H,3-4H2,1-2H3/t5-,6-,7+,8+,9-,10+/m1/s1 |
| InChIKey | NQWXWHUKPQAMDJ-MHCVYJKHSA-N |
| XLogP | 1.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |