C12H22N2 — CID 135258769
4,7-dimethyltricyclo[6.2.0.03,10]decane-2,9-diamine (PubChem CID 135258769) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 4,7-dimethyltricyclo[6.2.0.03,10]decane-2,9-diamine.
| Compound Name | 4,7-dimethyltricyclo[6.2.0.03,10]decane-2,9-diamine |
|---|---|
| PubChem CID | 135258769 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 4,7-dimethyltricyclo[6.2.0.03,10]decane-2,9-diamine |
| SMILES | CC1CCC(C)C2C(N)C3C1C(N)C23 |
| InChI | InChI=1S/C12H22N2/c1-5-3-4-6(2)8-10-9(12(8)14)7(5)11(10)13/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | NPZFHYQXQRYGCE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |