About CID 169427116
CID 169427116 (PubChem CID 169427116) has the molecular formula C10H18B
and a molecular weight of 149.07 g/mol.
Molecular Properties
| Compound Name | CID 169427116 |
| PubChem CID | 169427116 |
| Molecular Formula | C10H18B |
| Molecular Weight | 149.07 g/mol |
| Exact Mass | 149.15 |
| IUPAC Name | — |
| SMILES | CC1CCC2CCC(C)C12.[B] |
| InChI | InChI=1S/C10H18.B/c1-7-3-5-9-6-4-8(2)10(7)9;/h7-10H,3-6H2,1-2H3; |
| InChIKey | YSAAHXIVESIQTH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169427116 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169427116?
The IUPAC name of CID 169427116 (CID 169427116) is not available.
What is the SMILES notation for CID 169427116?
The canonical SMILES for CID 169427116 is CC1CCC2CCC(C)C12.[B].
What is the InChIKey of CID 169427116?
The InChIKey is YSAAHXIVESIQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18.B/c1-7-3-5-9-6-4-8(2)10(7)9;/h7-10H,3-6H2,1-2H3;.
What are the key properties of CID 169427116?
CID 169427116 has a molecular weight of 149.07 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169427116 is sourced from PubChem (CID 169427116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).