C5H10O — CID 173306707
(2R)-2,3-dimethylcyclopropan-1-ol (PubChem CID 173306707) has the molecular formula C5H10O and a molecular weight of 86.13 g/mol. Its IUPAC name is (2R)-2,3-dimethylcyclopropan-1-ol.
| Compound Name | (2R)-2,3-dimethylcyclopropan-1-ol |
|---|---|
| PubChem CID | 173306707 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | (2R)-2,3-dimethylcyclopropan-1-ol |
| SMILES | CC1C(O)[C@@H]1C |
| InChI | InChI=1S/C5H10O/c1-3-4(2)5(3)6/h3-6H,1-2H3/t3-,4?,5?/m1/s1 |
| InChIKey | WNFVRUVGFHJUPS-JYMNUSQCSA-N |
| XLogP | 0.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |