About (2R)-2,3-dimethylcyclopropan-1-ol
(2R)-2,3-dimethylcyclopropan-1-ol (PubChem CID 173306707) has the molecular formula C5H10O
and a molecular weight of 86.13 g/mol. Its IUPAC name is (2R)-2,3-dimethylcyclopropan-1-ol.
Molecular Properties
| Compound Name | (2R)-2,3-dimethylcyclopropan-1-ol |
| PubChem CID | 173306707 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | (2R)-2,3-dimethylcyclopropan-1-ol |
| SMILES | CC1C(O)[C@@H]1C |
| InChI | InChI=1S/C5H10O/c1-3-4(2)5(3)6/h3-6H,1-2H3/t3-,4?,5?/m1/s1 |
| InChIKey | WNFVRUVGFHJUPS-JYMNUSQCSA-N |
| XLogP | 0.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2,3-dimethylcyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-dimethylcyclopropan-1-ol?
The IUPAC name of (2R)-2,3-dimethylcyclopropan-1-ol (CID 173306707) is (2R)-2,3-dimethylcyclopropan-1-ol.
What is the SMILES notation for (2R)-2,3-dimethylcyclopropan-1-ol?
The canonical SMILES for (2R)-2,3-dimethylcyclopropan-1-ol is CC1C(O)[C@@H]1C.
What is the InChIKey of (2R)-2,3-dimethylcyclopropan-1-ol?
The InChIKey is WNFVRUVGFHJUPS-JYMNUSQCSA-N. The full InChI is InChI=1S/C5H10O/c1-3-4(2)5(3)6/h3-6H,1-2H3/t3-,4?,5?/m1/s1.
What are the key properties of (2R)-2,3-dimethylcyclopropan-1-ol?
(2R)-2,3-dimethylcyclopropan-1-ol has a molecular weight of 86.13 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-dimethylcyclopropan-1-ol is sourced from PubChem (CID 173306707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).